C22H19N3O3 — CID 146459738
6-[(E)-N'-methoxycarbamimidoyl]-1-(naphthalen-1-ylmethyl)indole-2-carboxylic acid (PubChem CID 146459738) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is 6-[(E)-N'-methoxycarbamimidoyl]-1-(naphthalen-1-ylmethyl)indole-2-carboxylic acid.
| Compound Name | 6-[(E)-N'-methoxycarbamimidoyl]-1-(naphthalen-1-ylmethyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 146459738 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 6-[(E)-N'-methoxycarbamimidoyl]-1-(naphthalen-1-ylmethyl)indole-2-carboxylic acid |
| SMILES | CO/N=C(/N)c1ccc2cc(C(=O)O)n(Cc3cccc4ccccc34)c2c1 |
| InChI | InChI=1S/C22H19N3O3/c1-28-24-21(23)16-10-9-15-11-20(22(26)27)25(19(15)12-16)13-17-7-4-6-14-5-2-3-8-18(14)17/h2-12H,13H2,1H3,(H2,23,24)(H,26,27) |
| InChIKey | YNLQGOKKFGTELL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|