C32H37N5O3 — CID 174040770
2-methylpropyl N-[2-[(1-methylpiperidin-4-yl)carbamoyl]-1-(naphthalen-1-ylmethyl)indole-6-carboximidoyl]carbamate (PubChem CID 174040770) has the molecular formula C32H37N5O3 and a molecular weight of 539.68 g/mol. Its IUPAC name is 2-methylpropyl N-[2-[(1-methylpiperidin-4-yl)carbamoyl]-1-(naphthalen-1-ylmethyl)indole-6-carboximidoyl]carbamate.
| Compound Name | 2-methylpropyl N-[2-[(1-methylpiperidin-4-yl)carbamoyl]-1-(naphthalen-1-ylmethyl)indole-6-carboximidoyl]carbamate |
|---|---|
| PubChem CID | 174040770 |
| Molecular Formula | C32H37N5O3 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | 2-methylpropyl N-[2-[(1-methylpiperidin-4-yl)carbamoyl]-1-(naphthalen-1-ylmethyl)indole-6-carboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OCC(C)C)c1ccc2cc(C(=O)NC3CCN(C)CC3)n(Cc3cccc4ccccc34)c2c1 |
| InChI | InChI=1S/C32H37N5O3/c1-21(2)20-40-32(39)35-30(33)24-12-11-23-17-29(31(38)34-26-13-15-36(3)16-14-26)37(28(23)18-24)19-25-9-6-8-22-7-4-5-10-27(22)25/h4-12,17-18,21,26H,13-16,19-20H2,1-3H3,(H,34,38)(H2,33,35,39) |
| InChIKey | XTHKEIVFTOOIRN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 99.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|