C27H29N5O — CID 167341024
N-(4-aminocyclohexyl)-6-carbamimidoyl-1-(naphthalen-1-ylmethyl)indole-3-carboxamide (PubChem CID 167341024) has the molecular formula C27H29N5O and a molecular weight of 439.56 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-6-carbamimidoyl-1-(naphthalen-1-ylmethyl)indole-3-carboxamide.
| Compound Name | N-(4-aminocyclohexyl)-6-carbamimidoyl-1-(naphthalen-1-ylmethyl)indole-3-carboxamide |
|---|---|
| PubChem CID | 167341024 |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | N-(4-aminocyclohexyl)-6-carbamimidoyl-1-(naphthalen-1-ylmethyl)indole-3-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc2c(C(=O)NC3CCC(N)CC3)cn(Cc3cccc4ccccc34)c2c1 |
| InChI | InChI=1S/C27H29N5O/c28-20-9-11-21(12-10-20)31-27(33)24-16-32(25-14-18(26(29)30)8-13-23(24)25)15-19-6-3-5-17-4-1-2-7-22(17)19/h1-8,13-14,16,20-21H,9-12,15,28H2,(H3,29,30)(H,31,33) |
| InChIKey | UIMBFAFCBBEHBT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 109.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|