C32H33N7O2 — CID 167340787
N-(4-aminocyclohexyl)-6-carbamimidoyl-3-methyl-1-[(3-pyrimidin-2-yloxynaphthalen-1-yl)methyl]indole-2-carboxamide (PubChem CID 167340787) has the molecular formula C32H33N7O2 and a molecular weight of 547.66 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-6-carbamimidoyl-3-methyl-1-[(3-pyrimidin-2-yloxynaphthalen-1-yl)methyl]indole-2-carboxamide.
| Compound Name | N-(4-aminocyclohexyl)-6-carbamimidoyl-3-methyl-1-[(3-pyrimidin-2-yloxynaphthalen-1-yl)methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 167340787 |
| Molecular Formula | C32H33N7O2 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | N-(4-aminocyclohexyl)-6-carbamimidoyl-3-methyl-1-[(3-pyrimidin-2-yloxynaphthalen-1-yl)methyl]indole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc2c(C)c(C(=O)NC3CCC(N)CC3)n(Cc3cc(Oc4ncccn4)cc4ccccc34)c2c1 |
| InChI | InChI=1S/C32H33N7O2/c1-19-26-12-7-21(30(34)35)17-28(26)39(29(19)31(40)38-24-10-8-23(33)9-11-24)18-22-16-25(41-32-36-13-4-14-37-32)15-20-5-2-3-6-27(20)22/h2-7,12-17,23-24H,8-11,18,33H2,1H3,(H3,34,35)(H,38,40) |
| InChIKey | QGHVHPQMDZQXPY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 144.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|