C32H36N6O5 — CID 174040782
ethyl N-[2-[(4-aminocyclohexyl)carbamoyl]-6-(N'-hydroxycarbamimidoyl)-1-[(4-phenoxyphenyl)methyl]indol-3-yl]carbamate (PubChem CID 174040782) has the molecular formula C32H36N6O5 and a molecular weight of 584.68 g/mol. Its IUPAC name is ethyl N-[2-[(4-aminocyclohexyl)carbamoyl]-6-(N'-hydroxycarbamimidoyl)-1-[(4-phenoxyphenyl)methyl]indol-3-yl]carbamate.
| Compound Name | ethyl N-[2-[(4-aminocyclohexyl)carbamoyl]-6-(N'-hydroxycarbamimidoyl)-1-[(4-phenoxyphenyl)methyl]indol-3-yl]carbamate |
|---|---|
| PubChem CID | 174040782 |
| Molecular Formula | C32H36N6O5 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | ethyl N-[2-[(4-aminocyclohexyl)carbamoyl]-6-(N'-hydroxycarbamimidoyl)-1-[(4-phenoxyphenyl)methyl]indol-3-yl]carbamate |
| SMILES | CCOC(=O)Nc1c(C(=O)NC2CCC(N)CC2)n(Cc2ccc(Oc3ccccc3)cc2)c2cc(C(N)=NO)ccc12 |
| InChI | InChI=1S/C32H36N6O5/c1-2-42-32(40)36-28-26-17-10-21(30(34)37-41)18-27(26)38(29(28)31(39)35-23-13-11-22(33)12-14-23)19-20-8-15-25(16-9-20)43-24-6-4-3-5-7-24/h3-10,15-18,22-23,41H,2,11-14,19,33H2,1H3,(H2,34,37)(H,35,39)(H,36,40) |
| InChIKey | UZXFENMTGQPALG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 166.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|