C24H29N6O4S+ — CID 167340849
[amino-[2-[(4-aminocyclohexyl)carbamoyl]-1-[2-(benzenesulfonyl)ethyl]-3-nitrosoindol-6-yl]methylidene]azanium (PubChem CID 167340849) has the molecular formula C24H29N6O4S+ and a molecular weight of 497.60 g/mol. Its IUPAC name is [amino-[2-[(4-aminocyclohexyl)carbamoyl]-1-[2-(benzenesulfonyl)ethyl]-3-nitrosoindol-6-yl]methylidene]azanium.
| Compound Name | [amino-[2-[(4-aminocyclohexyl)carbamoyl]-1-[2-(benzenesulfonyl)ethyl]-3-nitrosoindol-6-yl]methylidene]azanium |
|---|---|
| PubChem CID | 167340849 |
| Molecular Formula | C24H29N6O4S+ |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | [amino-[2-[(4-aminocyclohexyl)carbamoyl]-1-[2-(benzenesulfonyl)ethyl]-3-nitrosoindol-6-yl]methylidene]azanium |
| SMILES | NC(=[NH2+])c1ccc2c(N=O)c(C(=O)NC3CCC(N)CC3)n(CCS(=O)(=O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C24H28N6O4S/c25-16-7-9-17(10-8-16)28-24(31)22-21(29-32)19-11-6-15(23(26)27)14-20(19)30(22)12-13-35(33,34)18-4-2-1-3-5-18/h1-6,11,14,16-17H,7-10,12-13,25H2,(H3,26,27)(H,28,31)/p+1 |
| InChIKey | QPCHKZULXWERGT-UHFFFAOYSA-O |
| XLogP | 0.98 |
| TPSA | 175.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|