C27H30N6O — CID 167341292
3-amino-N-(4-aminocyclohexyl)-6-carbamimidoyl-1-(naphthalen-1-ylmethyl)indole-2-carboxamide (PubChem CID 167341292) has the molecular formula C27H30N6O and a molecular weight of 454.58 g/mol. Its IUPAC name is 3-amino-N-(4-aminocyclohexyl)-6-carbamimidoyl-1-(naphthalen-1-ylmethyl)indole-2-carboxamide.
| Compound Name | 3-amino-N-(4-aminocyclohexyl)-6-carbamimidoyl-1-(naphthalen-1-ylmethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 167341292 |
| Molecular Formula | C27H30N6O |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 3-amino-N-(4-aminocyclohexyl)-6-carbamimidoyl-1-(naphthalen-1-ylmethyl)indole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc2c(N)c(C(=O)NC3CCC(N)CC3)n(Cc3cccc4ccccc34)c2c1 |
| InChI | InChI=1S/C27H30N6O/c28-19-9-11-20(12-10-19)32-27(34)25-24(29)22-13-8-17(26(30)31)14-23(22)33(25)15-18-6-3-5-16-4-1-2-7-21(16)18/h1-8,13-14,19-20H,9-12,15,28-29H2,(H3,30,31)(H,32,34) |
| InChIKey | PXKVFAXYDWZMAW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|