C28H31N5O2 — CID 156770640
6-[N'-(4-aminocyclohexyl)carbamimidoyl]-3-(hydroxymethyl)-1-(naphthalen-1-ylmethyl)indole-2-carboxamide (PubChem CID 156770640) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 6-[N'-(4-aminocyclohexyl)carbamimidoyl]-3-(hydroxymethyl)-1-(naphthalen-1-ylmethyl)indole-2-carboxamide.
| Compound Name | 6-[N'-(4-aminocyclohexyl)carbamimidoyl]-3-(hydroxymethyl)-1-(naphthalen-1-ylmethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 156770640 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 6-[N'-(4-aminocyclohexyl)carbamimidoyl]-3-(hydroxymethyl)-1-(naphthalen-1-ylmethyl)indole-2-carboxamide |
| SMILES | NC(=O)c1c(CO)c2ccc(/C(N)=N/C3CCC(N)CC3)cc2n1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C28H31N5O2/c29-20-9-11-21(12-10-20)32-27(30)18-8-13-23-24(16-34)26(28(31)35)33(25(23)14-18)15-19-6-3-5-17-4-1-2-7-22(17)19/h1-8,13-14,20-21,34H,9-12,15-16,29H2,(H2,30,32)(H2,31,35) |
| InChIKey | XTGBPCGLLJAZSX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 132.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|