C21H21ClN2O2 — CID 10270421
1-[(2-chlorophenyl)methyl]-3-ethyl-2-propanoylindole-6-carboxamide (PubChem CID 10270421) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-ethyl-2-propanoylindole-6-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-ethyl-2-propanoylindole-6-carboxamide |
|---|---|
| PubChem CID | 10270421 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-ethyl-2-propanoylindole-6-carboxamide |
| SMILES | CCC(=O)c1c(CC)c2ccc(C(N)=O)cc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C21H21ClN2O2/c1-3-15-16-10-9-13(21(23)26)11-18(16)24(20(15)19(25)4-2)12-14-7-5-6-8-17(14)22/h5-11H,3-4,12H2,1-2H3,(H2,23,26) |
| InChIKey | GHNXEXPUXOJJEL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|