C24H26ClNO3 — CID 22627428
methyl 1-[(2-chlorophenyl)methyl]-2-(2-methylpropanoyl)-3-propylindole-6-carboxylate (PubChem CID 22627428) has the molecular formula C24H26ClNO3 and a molecular weight of 411.93 g/mol. Its IUPAC name is methyl 1-[(2-chlorophenyl)methyl]-2-(2-methylpropanoyl)-3-propylindole-6-carboxylate.
| Compound Name | methyl 1-[(2-chlorophenyl)methyl]-2-(2-methylpropanoyl)-3-propylindole-6-carboxylate |
|---|---|
| PubChem CID | 22627428 |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | methyl 1-[(2-chlorophenyl)methyl]-2-(2-methylpropanoyl)-3-propylindole-6-carboxylate |
| SMILES | CCCc1c(C(=O)C(C)C)n(Cc2ccccc2Cl)c2cc(C(=O)OC)ccc12 |
| InChI | InChI=1S/C24H26ClNO3/c1-5-8-19-18-12-11-16(24(28)29-4)13-21(18)26(22(19)23(27)15(2)3)14-17-9-6-7-10-20(17)25/h6-7,9-13,15H,5,8,14H2,1-4H3 |
| InChIKey | LQGFIJVZLBILOS-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|