C24H26ClNO3 — CID 139765111
methyl 3-[(2-chlorophenyl)methyl]-1-(2-methylpropanoyl)-2-propylindolizine-6-carboxylate (PubChem CID 139765111) has the molecular formula C24H26ClNO3 and a molecular weight of 411.93 g/mol. Its IUPAC name is methyl 3-[(2-chlorophenyl)methyl]-1-(2-methylpropanoyl)-2-propylindolizine-6-carboxylate.
| Compound Name | methyl 3-[(2-chlorophenyl)methyl]-1-(2-methylpropanoyl)-2-propylindolizine-6-carboxylate |
|---|---|
| PubChem CID | 139765111 |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | methyl 3-[(2-chlorophenyl)methyl]-1-(2-methylpropanoyl)-2-propylindolizine-6-carboxylate |
| SMILES | CCCc1c(C(=O)C(C)C)c2ccc(C(=O)OC)cn2c1Cc1ccccc1Cl |
| InChI | InChI=1S/C24H26ClNO3/c1-5-8-18-21(13-16-9-6-7-10-19(16)25)26-14-17(24(28)29-4)11-12-20(26)22(18)23(27)15(2)3/h6-7,9-12,14-15H,5,8,13H2,1-4H3 |
| InChIKey | LZMWZPCFRWYZPG-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |