C20H20ClNO2 — CID 11131658
methyl 3-[(2-chlorophenyl)methyl]-2-propylindolizine-6-carboxylate (PubChem CID 11131658) has the molecular formula C20H20ClNO2 and a molecular weight of 341.84 g/mol. Its IUPAC name is methyl 3-[(2-chlorophenyl)methyl]-2-propylindolizine-6-carboxylate.
| Compound Name | methyl 3-[(2-chlorophenyl)methyl]-2-propylindolizine-6-carboxylate |
|---|---|
| PubChem CID | 11131658 |
| Molecular Formula | C20H20ClNO2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | methyl 3-[(2-chlorophenyl)methyl]-2-propylindolizine-6-carboxylate |
| SMILES | CCCc1cc2ccc(C(=O)OC)cn2c1Cc1ccccc1Cl |
| InChI | InChI=1S/C20H20ClNO2/c1-3-6-15-11-17-10-9-16(20(23)24-2)13-22(17)19(15)12-14-7-4-5-8-18(14)21/h4-5,7-11,13H,3,6,12H2,1-2H3 |
| InChIKey | FOVKNIMGFRVFBV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |