C25H28ClNO3 — CID 10137253
methyl 1-[(2-chlorophenyl)methyl]-3-(3-methylbutanoyl)-2-propylindole-6-carboxylate (PubChem CID 10137253) has the molecular formula C25H28ClNO3 and a molecular weight of 425.96 g/mol. Its IUPAC name is methyl 1-[(2-chlorophenyl)methyl]-3-(3-methylbutanoyl)-2-propylindole-6-carboxylate.
| Compound Name | methyl 1-[(2-chlorophenyl)methyl]-3-(3-methylbutanoyl)-2-propylindole-6-carboxylate |
|---|---|
| PubChem CID | 10137253 |
| Molecular Formula | C25H28ClNO3 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | methyl 1-[(2-chlorophenyl)methyl]-3-(3-methylbutanoyl)-2-propylindole-6-carboxylate |
| SMILES | CCCc1c(C(=O)CC(C)C)c2ccc(C(=O)OC)cc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C25H28ClNO3/c1-5-8-21-24(23(28)13-16(2)3)19-12-11-17(25(29)30-4)14-22(19)27(21)15-18-9-6-7-10-20(18)26/h6-7,9-12,14,16H,5,8,13,15H2,1-4H3 |
| InChIKey | UVOJNOFSRFWUQD-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |