C24H26ClNO4 — CID 22627302
methyl 1-[(2-chlorophenyl)methyl]-3-(2-ethoxyacetyl)-2-propylindole-6-carboxylate (PubChem CID 22627302) has the molecular formula C24H26ClNO4 and a molecular weight of 427.93 g/mol. Its IUPAC name is methyl 1-[(2-chlorophenyl)methyl]-3-(2-ethoxyacetyl)-2-propylindole-6-carboxylate.
| Compound Name | methyl 1-[(2-chlorophenyl)methyl]-3-(2-ethoxyacetyl)-2-propylindole-6-carboxylate |
|---|---|
| PubChem CID | 22627302 |
| Molecular Formula | C24H26ClNO4 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | methyl 1-[(2-chlorophenyl)methyl]-3-(2-ethoxyacetyl)-2-propylindole-6-carboxylate |
| SMILES | CCCc1c(C(=O)COCC)c2ccc(C(=O)OC)cc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C24H26ClNO4/c1-4-8-20-23(22(27)15-30-5-2)18-12-11-16(24(28)29-3)13-21(18)26(20)14-17-9-6-7-10-19(17)25/h6-7,9-13H,4-5,8,14-15H2,1-3H3 |
| InChIKey | ZXBKLAMBLHKYBM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |