C24H26ClNO3 — CID 10223376
1-[(2-chlorophenyl)methyl]-3-(3-methylbutanoyl)-2-propylindole-6-carboxylic acid (PubChem CID 10223376) has the molecular formula C24H26ClNO3 and a molecular weight of 411.93 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-(3-methylbutanoyl)-2-propylindole-6-carboxylic acid.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-(3-methylbutanoyl)-2-propylindole-6-carboxylic acid |
|---|---|
| PubChem CID | 10223376 |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-(3-methylbutanoyl)-2-propylindole-6-carboxylic acid |
| SMILES | CCCc1c(C(=O)CC(C)C)c2ccc(C(=O)O)cc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C24H26ClNO3/c1-4-7-20-23(22(27)12-15(2)3)18-11-10-16(24(28)29)13-21(18)26(20)14-17-8-5-6-9-19(17)25/h5-6,8-11,13,15H,4,7,12,14H2,1-3H3,(H,28,29) |
| InChIKey | HGGBDTFMRCEOCP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |