C18H16ClNO2 — CID 150063466
1-[(2-chlorophenyl)methyl]-2-ethylindole-6-carboxylic acid (PubChem CID 150063466) has the molecular formula C18H16ClNO2 and a molecular weight of 313.78 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-2-ethylindole-6-carboxylic acid.
| Compound Name | 1-[(2-chlorophenyl)methyl]-2-ethylindole-6-carboxylic acid |
|---|---|
| PubChem CID | 150063466 |
| Molecular Formula | C18H16ClNO2 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-2-ethylindole-6-carboxylic acid |
| SMILES | CCc1cc2ccc(C(=O)O)cc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C18H16ClNO2/c1-2-15-9-12-7-8-13(18(21)22)10-17(12)20(15)11-14-5-3-4-6-16(14)19/h3-10H,2,11H2,1H3,(H,21,22) |
| InChIKey | DNTURBKPOJUGBR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |