C18H17NO3 — CID 117180897
1-ethyl-2-(phenoxymethyl)indole-6-carboxylic acid (PubChem CID 117180897) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-ethyl-2-(phenoxymethyl)indole-6-carboxylic acid.
| Compound Name | 1-ethyl-2-(phenoxymethyl)indole-6-carboxylic acid |
|---|---|
| PubChem CID | 117180897 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-ethyl-2-(phenoxymethyl)indole-6-carboxylic acid |
| SMILES | CCn1c(COc2ccccc2)cc2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C18H17NO3/c1-2-19-15(12-22-16-6-4-3-5-7-16)10-13-8-9-14(18(20)21)11-17(13)19/h3-11H,2,12H2,1H3,(H,20,21) |
| InChIKey | OEHWNNQNJQRDSQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |