C24H18F3NO3S — CID 150571753
2-(phenoxymethyl)-1-[[2-(trifluoromethylsulfanyl)phenyl]methyl]indole-5-carboxylic acid (PubChem CID 150571753) has the molecular formula C24H18F3NO3S and a molecular weight of 457.47 g/mol. Its IUPAC name is 2-(phenoxymethyl)-1-[[2-(trifluoromethylsulfanyl)phenyl]methyl]indole-5-carboxylic acid.
| Compound Name | 2-(phenoxymethyl)-1-[[2-(trifluoromethylsulfanyl)phenyl]methyl]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 150571753 |
| Molecular Formula | C24H18F3NO3S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 2-(phenoxymethyl)-1-[[2-(trifluoromethylsulfanyl)phenyl]methyl]indole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)cc(COc1ccccc1)n2Cc1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C24H18F3NO3S/c25-24(26,27)32-22-9-5-4-6-17(22)14-28-19(15-31-20-7-2-1-3-8-20)13-18-12-16(23(29)30)10-11-21(18)28/h1-13H,14-15H2,(H,29,30) |
| InChIKey | ILZJUPYISUHKTJ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |