About [2-(phenoxymethyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-5-yl] N-cyclopropylcarbamate
[2-(phenoxymethyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-5-yl] N-cyclopropylcarbamate (PubChem CID 69107032) has the molecular formula C27H23F3N2O4
and a molecular weight of 496.49 g/mol. Its IUPAC name is [2-(phenoxymethyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-5-yl] N-cyclopropylcarbamate.
Molecular Properties
| Compound Name | [2-(phenoxymethyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-5-yl] N-cyclopropylcarbamate |
| PubChem CID | 69107032 |
| Molecular Formula | C27H23F3N2O4 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | [2-(phenoxymethyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-5-yl] N-cyclopropylcarbamate |
| SMILES | O=C(NC1CC1)Oc1ccc2c(c1)cc(COc1ccccc1)n2Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C27H23F3N2O4/c28-27(29,30)36-23-10-6-18(7-11-23)16-32-21(17-34-22-4-2-1-3-5-22)14-19-15-24(12-13-25(19)32)35-26(33)31-20-8-9-20/h1-7,10-15,20H,8-9,16-17H2,(H,31,33) |
| InChIKey | XZVFYQWCQVRFKN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(phenoxymethyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-5-yl] N-cyclopropylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(phenoxymethyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-5-yl] N-cyclopropylcarbamate?
The IUPAC name of [2-(phenoxymethyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-5-yl] N-cyclopropylcarbamate (CID 69107032) is [2-(phenoxymethyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-5-yl] N-cyclopropylcarbamate.
What is the SMILES notation for [2-(phenoxymethyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-5-yl] N-cyclopropylcarbamate?
The canonical SMILES for [2-(phenoxymethyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-5-yl] N-cyclopropylcarbamate is O=C(NC1CC1)Oc1ccc2c(c1)cc(COc1ccccc1)n2Cc1ccc(OC(F)(F)F)cc1.
What is the InChIKey of [2-(phenoxymethyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-5-yl] N-cyclopropylcarbamate?
The InChIKey is XZVFYQWCQVRFKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23F3N2O4/c28-27(29,30)36-23-10-6-18(7-11-23)16-32-21(17-34-22-4-2-1-3-5-22)14-19-15-24(12-13-25(19)32)35-26(33)31-20-8-9-20/h1-7,10-15,20H,8-9,16-17H2,(H,31,33).
What are the key properties of [2-(phenoxymethyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-5-yl] N-cyclopropylcarbamate?
[2-(phenoxymethyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-5-yl] N-cyclopropylcarbamate has a molecular weight of 496.49 g/mol, XLogP of 6.42, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(phenoxymethyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-5-yl] N-cyclopropylcarbamate is sourced from PubChem (CID 69107032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).