C23H16F3NO3 — CID 67684519
3-[[2-phenyl-5-(trifluoromethoxy)indol-1-yl]methyl]benzoic acid (PubChem CID 67684519) has the molecular formula C23H16F3NO3 and a molecular weight of 411.38 g/mol. Its IUPAC name is 3-[[2-phenyl-5-(trifluoromethoxy)indol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[2-phenyl-5-(trifluoromethoxy)indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 67684519 |
| Molecular Formula | C23H16F3NO3 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 3-[[2-phenyl-5-(trifluoromethoxy)indol-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(Cn2c(-c3ccccc3)cc3cc(OC(F)(F)F)ccc32)c1 |
| InChI | InChI=1S/C23H16F3NO3/c24-23(25,26)30-19-9-10-20-18(12-19)13-21(16-6-2-1-3-7-16)27(20)14-15-5-4-8-17(11-15)22(28)29/h1-13H,14H2,(H,28,29) |
| InChIKey | UJVBTDXOIWNAAC-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |