methyl 3-[(5-methoxy-2-propan-2-ylindol-1-yl)methyl]benzoate

C21H23NO3 — CID 67684489

IUPACmethyl 3-[(5-methoxy-2-propan-2-ylindol-1-yl)methyl]benzoate
SMILESCOC(=O)c1cccc(Cn2c(C(C)C)cc3cc(OC)ccc32)c1
InChIInChI=1S/C21H23NO3/c1-14(2)20-12-17-11-18(24-3)8-9-19(17)22(20)13-15-6-5-7-16(10-15)21(23)25-4/h5-12,14H,13H2,1-4H3
InChIKeyJQYLXXWKLICLTL-UHFFFAOYSA-N
MW337.42 g/mol
LogP4.61
Rot. Bonds5

About methyl 3-[(5-methoxy-2-propan-2-ylindol-1-yl)methyl]benzoate

methyl 3-[(5-methoxy-2-propan-2-ylindol-1-yl)methyl]benzoate (PubChem CID 67684489) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl 3-[(5-methoxy-2-propan-2-ylindol-1-yl)methyl]benzoate.

Molecular Properties

Compound Namemethyl 3-[(5-methoxy-2-propan-2-ylindol-1-yl)methyl]benzoate
PubChem CID67684489
Molecular FormulaC21H23NO3
Molecular Weight337.42 g/mol
Exact Mass337.17
IUPAC Namemethyl 3-[(5-methoxy-2-propan-2-ylindol-1-yl)methyl]benzoate
SMILESCOC(=O)c1cccc(Cn2c(C(C)C)cc3cc(OC)ccc32)c1
InChIInChI=1S/C21H23NO3/c1-14(2)20-12-17-11-18(24-3)8-9-19(17)22(20)13-15-6-5-7-16(10-15)21(23)25-4/h5-12,14H,13H2,1-4H3
InChIKeyJQYLXXWKLICLTL-UHFFFAOYSA-N
XLogP4.61
TPSA40.46 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500337.42
LogP ≤ 54.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-[(5-methoxy-2-propan-2-ylindol-1-yl)methyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(5-methoxy-2-propan-2-ylindol-1-yl)methyl]benzoate?
The IUPAC name of methyl 3-[(5-methoxy-2-propan-2-ylindol-1-yl)methyl]benzoate (CID 67684489) is methyl 3-[(5-methoxy-2-propan-2-ylindol-1-yl)methyl]benzoate.
What is the SMILES notation for methyl 3-[(5-methoxy-2-propan-2-ylindol-1-yl)methyl]benzoate?
The canonical SMILES for methyl 3-[(5-methoxy-2-propan-2-ylindol-1-yl)methyl]benzoate is COC(=O)c1cccc(Cn2c(C(C)C)cc3cc(OC)ccc32)c1.
What is the InChIKey of methyl 3-[(5-methoxy-2-propan-2-ylindol-1-yl)methyl]benzoate?
The InChIKey is JQYLXXWKLICLTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO3/c1-14(2)20-12-17-11-18(24-3)8-9-19(17)22(20)13-15-6-5-7-16(10-15)21(23)25-4/h5-12,14H,13H2,1-4H3.
What are the key properties of methyl 3-[(5-methoxy-2-propan-2-ylindol-1-yl)methyl]benzoate?
methyl 3-[(5-methoxy-2-propan-2-ylindol-1-yl)methyl]benzoate has a molecular weight of 337.42 g/mol, XLogP of 4.61, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(5-methoxy-2-propan-2-ylindol-1-yl)methyl]benzoate is sourced from PubChem (CID 67684489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).