C17H11ClF3NO3 — CID 141247478
5-chloro-1-[[4-(trifluoromethoxy)phenyl]methyl]indole-2-carboxylic acid (PubChem CID 141247478) has the molecular formula C17H11ClF3NO3 and a molecular weight of 369.73 g/mol. Its IUPAC name is 5-chloro-1-[[4-(trifluoromethoxy)phenyl]methyl]indole-2-carboxylic acid.
| Compound Name | 5-chloro-1-[[4-(trifluoromethoxy)phenyl]methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 141247478 |
| Molecular Formula | C17H11ClF3NO3 |
| Molecular Weight | 369.73 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 5-chloro-1-[[4-(trifluoromethoxy)phenyl]methyl]indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(Cl)ccc2n1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H11ClF3NO3/c18-12-3-6-14-11(7-12)8-15(16(23)24)22(14)9-10-1-4-13(5-2-10)25-17(19,20)21/h1-8H,9H2,(H,23,24) |
| InChIKey | WZUOUEGTEOCRFP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.73 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |