C19H15ClF3NO4 — CID 22259366
ethyl 1-[[3-chloro-4-(trifluoromethoxy)phenyl]methyl]-5-hydroxyindole-2-carboxylate (PubChem CID 22259366) has the molecular formula C19H15ClF3NO4 and a molecular weight of 413.78 g/mol. Its IUPAC name is ethyl 1-[[3-chloro-4-(trifluoromethoxy)phenyl]methyl]-5-hydroxyindole-2-carboxylate.
| Compound Name | ethyl 1-[[3-chloro-4-(trifluoromethoxy)phenyl]methyl]-5-hydroxyindole-2-carboxylate |
|---|---|
| PubChem CID | 22259366 |
| Molecular Formula | C19H15ClF3NO4 |
| Molecular Weight | 413.78 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | ethyl 1-[[3-chloro-4-(trifluoromethoxy)phenyl]methyl]-5-hydroxyindole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(O)ccc2n1Cc1ccc(OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C19H15ClF3NO4/c1-2-27-18(26)16-9-12-8-13(25)4-5-15(12)24(16)10-11-3-6-17(14(20)7-11)28-19(21,22)23/h3-9,25H,2,10H2,1H3 |
| InChIKey | KNBLQUJNHRRPFU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.78 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |