C19H14F3NO4 — CID 142731706
methyl 2-oxo-1-[[4-(trifluoromethoxy)phenyl]methyl]quinoline-3-carboxylate (PubChem CID 142731706) has the molecular formula C19H14F3NO4 and a molecular weight of 377.32 g/mol. Its IUPAC name is methyl 2-oxo-1-[[4-(trifluoromethoxy)phenyl]methyl]quinoline-3-carboxylate.
| Compound Name | methyl 2-oxo-1-[[4-(trifluoromethoxy)phenyl]methyl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 142731706 |
| Molecular Formula | C19H14F3NO4 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | methyl 2-oxo-1-[[4-(trifluoromethoxy)phenyl]methyl]quinoline-3-carboxylate |
| SMILES | COC(=O)c1cc2ccccc2n(Cc2ccc(OC(F)(F)F)cc2)c1=O |
| InChI | InChI=1S/C19H14F3NO4/c1-26-18(25)15-10-13-4-2-3-5-16(13)23(17(15)24)11-12-6-8-14(9-7-12)27-19(20,21)22/h2-10H,11H2,1H3 |
| InChIKey | RXDGWKKPBBSWDH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |