C20H18ClF3N2O3 — CID 68815177
chloro (2S)-2-amino-3-[2-methyl-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-3-yl]propanoate (PubChem CID 68815177) has the molecular formula C20H18ClF3N2O3 and a molecular weight of 426.82 g/mol. Its IUPAC name is chloro (2S)-2-amino-3-[2-methyl-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-3-yl]propanoate.
| Compound Name | chloro (2S)-2-amino-3-[2-methyl-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-3-yl]propanoate |
|---|---|
| PubChem CID | 68815177 |
| Molecular Formula | C20H18ClF3N2O3 |
| Molecular Weight | 426.82 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | chloro (2S)-2-amino-3-[2-methyl-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-3-yl]propanoate |
| SMILES | Cc1c(C[C@H](N)C(=O)OCl)c2ccccc2n1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18ClF3N2O3/c1-12-16(10-17(25)19(27)29-21)15-4-2-3-5-18(15)26(12)11-13-6-8-14(9-7-13)28-20(22,23)24/h2-9,17H,10-11,25H2,1H3/t17-/m0/s1 |
| InChIKey | IVQVVMHDWVSPRB-KRWDZBQOSA-N |
| XLogP | 4.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.82 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|