C31H29F3N2O7S — CID 44592768
2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[5-methoxy-2-methyl-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-3-yl]propanoic acid (PubChem CID 44592768) has the molecular formula C31H29F3N2O7S and a molecular weight of 630.64 g/mol. Its IUPAC name is 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[5-methoxy-2-methyl-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-3-yl]propanoic acid.
| Compound Name | 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[5-methoxy-2-methyl-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 44592768 |
| Molecular Formula | C31H29F3N2O7S |
| Molecular Weight | 630.64 g/mol |
| Exact Mass | 630.16 |
| IUPAC Name | 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[5-methoxy-2-methyl-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-3-yl]propanoic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)NC(Cc2c(C)n(Cc3ccc(OC(F)(F)F)cc3)c3ccc(OC)cc23)C(=O)O)cc1 |
| InChI | InChI=1S/C31H29F3N2O7S/c1-4-5-16-42-22-10-13-25(14-11-22)44(39,40)35-28(30(37)38)18-26-20(2)36(29-15-12-24(41-3)17-27(26)29)19-21-6-8-23(9-7-21)43-31(32,33)34/h6-15,17,28,35H,16,18-19H2,1-3H3,(H,37,38) |
| InChIKey | MPXXKNZEBNNEBF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.64 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|