C30H30N2O7S — CID 68814758
(2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[5-methoxy-1-[(2-methoxyphenyl)methyl]indol-3-yl]propanoic acid (PubChem CID 68814758) has the molecular formula C30H30N2O7S and a molecular weight of 562.64 g/mol. Its IUPAC name is (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[5-methoxy-1-[(2-methoxyphenyl)methyl]indol-3-yl]propanoic acid.
| Compound Name | (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[5-methoxy-1-[(2-methoxyphenyl)methyl]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 68814758 |
| Molecular Formula | C30H30N2O7S |
| Molecular Weight | 562.64 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[5-methoxy-1-[(2-methoxyphenyl)methyl]indol-3-yl]propanoic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N[C@@H](Cc2cn(Cc3ccccc3OC)c3ccc(OC)cc23)C(=O)O)cc1 |
| InChI | InChI=1S/C30H30N2O7S/c1-4-5-16-39-23-10-13-25(14-11-23)40(35,36)31-27(30(33)34)17-22-20-32(19-21-8-6-7-9-29(21)38-3)28-15-12-24(37-2)18-26(22)28/h6-15,18,20,27,31H,16-17,19H2,1-3H3,(H,33,34)/t27-/m0/s1 |
| InChIKey | USUSSNHISYJARB-MHZLTWQESA-N |
| XLogP | 4.08 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.64 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|