C29H25FN2O7S — CID 68812957
3-[2-[(4-but-2-ynoxyphenyl)sulfonylamino]-2-carboxyethyl]-1-[(3-fluorophenyl)methyl]indole-5-carboxylic acid (PubChem CID 68812957) has the molecular formula C29H25FN2O7S and a molecular weight of 564.59 g/mol. Its IUPAC name is 3-[2-[(4-but-2-ynoxyphenyl)sulfonylamino]-2-carboxyethyl]-1-[(3-fluorophenyl)methyl]indole-5-carboxylic acid.
| Compound Name | 3-[2-[(4-but-2-ynoxyphenyl)sulfonylamino]-2-carboxyethyl]-1-[(3-fluorophenyl)methyl]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 68812957 |
| Molecular Formula | C29H25FN2O7S |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | 3-[2-[(4-but-2-ynoxyphenyl)sulfonylamino]-2-carboxyethyl]-1-[(3-fluorophenyl)methyl]indole-5-carboxylic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)NC(Cc2cn(Cc3cccc(F)c3)c3ccc(C(=O)O)cc23)C(=O)O)cc1 |
| InChI | InChI=1S/C29H25FN2O7S/c1-2-3-13-39-23-8-10-24(11-9-23)40(37,38)31-26(29(35)36)16-21-18-32(17-19-5-4-6-22(30)14-19)27-12-7-20(28(33)34)15-25(21)27/h4-12,14-15,18,26,31H,13,16-17H2,1H3,(H,33,34)(H,35,36) |
| InChIKey | UVGDPMNGAIYEJW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|