C28H26N2O6S — CID 68815280
(2R)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[1-[(4-hydroxyphenyl)methyl]indol-3-yl]propanoic acid (PubChem CID 68815280) has the molecular formula C28H26N2O6S and a molecular weight of 518.59 g/mol. Its IUPAC name is (2R)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[1-[(4-hydroxyphenyl)methyl]indol-3-yl]propanoic acid.
| Compound Name | (2R)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[1-[(4-hydroxyphenyl)methyl]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 68815280 |
| Molecular Formula | C28H26N2O6S |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | (2R)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[1-[(4-hydroxyphenyl)methyl]indol-3-yl]propanoic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N[C@H](Cc2cn(Cc3ccc(O)cc3)c3ccccc23)C(=O)O)cc1 |
| InChI | InChI=1S/C28H26N2O6S/c1-2-3-16-36-23-12-14-24(15-13-23)37(34,35)29-26(28(32)33)17-21-19-30(27-7-5-4-6-25(21)27)18-20-8-10-22(31)11-9-20/h4-15,19,26,29,31H,16-18H2,1H3,(H,32,33)/t26-/m1/s1 |
| InChIKey | OTCPAMZCNOHDCS-AREMUKBSSA-N |
| XLogP | 3.77 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|