C29H24ClF3N2O6S — CID 68812953
(2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[5-chloro-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-3-yl]propanoic acid (PubChem CID 68812953) has the molecular formula C29H24ClF3N2O6S and a molecular weight of 621.03 g/mol. Its IUPAC name is (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[5-chloro-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-3-yl]propanoic acid.
| Compound Name | (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[5-chloro-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 68812953 |
| Molecular Formula | C29H24ClF3N2O6S |
| Molecular Weight | 621.03 g/mol |
| Exact Mass | 620.10 |
| IUPAC Name | (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[5-chloro-1-[[4-(trifluoromethoxy)phenyl]methyl]indol-3-yl]propanoic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N[C@@H](Cc2cn(Cc3ccc(OC(F)(F)F)cc3)c3ccc(Cl)cc23)C(=O)O)cc1 |
| InChI | InChI=1S/C29H24ClF3N2O6S/c1-2-3-14-40-22-9-11-24(12-10-22)42(38,39)34-26(28(36)37)15-20-18-35(27-13-6-21(30)16-25(20)27)17-19-4-7-23(8-5-19)41-29(31,32)33/h4-13,16,18,26,34H,14-15,17H2,1H3,(H,36,37)/t26-/m0/s1 |
| InChIKey | UGVKHCRKJSCMPB-SANMLTNESA-N |
| XLogP | 5.62 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.03 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|