C30H27F3N2O6S — CID 11678805
2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[5-methoxy-1-[[2-(trifluoromethyl)phenyl]methyl]indol-3-yl]propanoic acid (PubChem CID 11678805) has the molecular formula C30H27F3N2O6S and a molecular weight of 600.62 g/mol. Its IUPAC name is 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[5-methoxy-1-[[2-(trifluoromethyl)phenyl]methyl]indol-3-yl]propanoic acid.
| Compound Name | 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[5-methoxy-1-[[2-(trifluoromethyl)phenyl]methyl]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 11678805 |
| Molecular Formula | C30H27F3N2O6S |
| Molecular Weight | 600.62 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | 2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[5-methoxy-1-[[2-(trifluoromethyl)phenyl]methyl]indol-3-yl]propanoic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)NC(Cc2cn(Cc3ccccc3C(F)(F)F)c3ccc(OC)cc23)C(=O)O)cc1 |
| InChI | InChI=1S/C30H27F3N2O6S/c1-3-4-15-41-22-9-12-24(13-10-22)42(38,39)34-27(29(36)37)16-21-19-35(28-14-11-23(40-2)17-25(21)28)18-20-7-5-6-8-26(20)30(31,32)33/h5-14,17,19,27,34H,15-16,18H2,1-2H3,(H,36,37) |
| InChIKey | JBWSOOKDPNOCEX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|