C29H27FN2O5S — CID 68812447
(2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[1-[(3-fluorophenyl)methyl]-2-methylindol-3-yl]propanoic acid (PubChem CID 68812447) has the molecular formula C29H27FN2O5S and a molecular weight of 534.61 g/mol. Its IUPAC name is (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[1-[(3-fluorophenyl)methyl]-2-methylindol-3-yl]propanoic acid.
| Compound Name | (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[1-[(3-fluorophenyl)methyl]-2-methylindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 68812447 |
| Molecular Formula | C29H27FN2O5S |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[1-[(3-fluorophenyl)methyl]-2-methylindol-3-yl]propanoic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N[C@@H](Cc2c(C)n(Cc3cccc(F)c3)c3ccccc23)C(=O)O)cc1 |
| InChI | InChI=1S/C29H27FN2O5S/c1-3-4-16-37-23-12-14-24(15-13-23)38(35,36)31-27(29(33)34)18-26-20(2)32(28-11-6-5-10-25(26)28)19-21-8-7-9-22(30)17-21/h5-15,17,27,31H,16,18-19H2,1-2H3,(H,33,34)/t27-/m0/s1 |
| InChIKey | CMHUBZIPUQVCRC-MHZLTWQESA-N |
| XLogP | 4.51 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|