C30H30N2O5S — CID 68814602
(2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[2-methyl-1-[(2-methylphenyl)methyl]indol-3-yl]propanoic acid (PubChem CID 68814602) has the molecular formula C30H30N2O5S and a molecular weight of 530.65 g/mol. Its IUPAC name is (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[2-methyl-1-[(2-methylphenyl)methyl]indol-3-yl]propanoic acid.
| Compound Name | (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[2-methyl-1-[(2-methylphenyl)methyl]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 68814602 |
| Molecular Formula | C30H30N2O5S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-[2-methyl-1-[(2-methylphenyl)methyl]indol-3-yl]propanoic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N[C@@H](Cc2c(C)n(Cc3ccccc3C)c3ccccc23)C(=O)O)cc1 |
| InChI | InChI=1S/C30H30N2O5S/c1-4-5-18-37-24-14-16-25(17-15-24)38(35,36)31-28(30(33)34)19-27-22(3)32(29-13-9-8-12-26(27)29)20-23-11-7-6-10-21(23)2/h6-17,28,31H,18-20H2,1-3H3,(H,33,34)/t28-/m0/s1 |
| InChIKey | RHEOFSQRKUFRCU-NDEPHWFRSA-N |
| XLogP | 4.68 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|