C23H24N2O6S — CID 68815122
(2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-(5-methoxy-2-methyl-1H-indol-3-yl)propanoic acid (PubChem CID 68815122) has the molecular formula C23H24N2O6S and a molecular weight of 456.52 g/mol. Its IUPAC name is (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-(5-methoxy-2-methyl-1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-(5-methoxy-2-methyl-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 68815122 |
| Molecular Formula | C23H24N2O6S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | (2S)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]-3-(5-methoxy-2-methyl-1H-indol-3-yl)propanoic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N[C@@H](Cc2c(C)[nH]c3ccc(OC)cc23)C(=O)O)cc1 |
| InChI | InChI=1S/C23H24N2O6S/c1-4-5-12-31-16-6-9-18(10-7-16)32(28,29)25-22(23(26)27)14-19-15(2)24-21-11-8-17(30-3)13-20(19)21/h6-11,13,22,24-25H,12,14H2,1-3H3,(H,26,27)/t22-/m0/s1 |
| InChIKey | CEBTZXYFMCDWFR-QFIPXVFZSA-N |
| XLogP | 2.86 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|