C17H28N2O3 — CID 145142423
2-amino-3-(5-methoxy-2-methyl-1H-indol-3-yl)propanoic acid;ethane (PubChem CID 145142423) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-amino-3-(5-methoxy-2-methyl-1H-indol-3-yl)propanoic acid;ethane.
| Compound Name | 2-amino-3-(5-methoxy-2-methyl-1H-indol-3-yl)propanoic acid;ethane |
|---|---|
| PubChem CID | 145142423 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 2-amino-3-(5-methoxy-2-methyl-1H-indol-3-yl)propanoic acid;ethane |
| SMILES | CC.CC.COc1ccc2[nH]c(C)c(CC(N)C(=O)O)c2c1 |
| InChI | InChI=1S/C13H16N2O3.2C2H6/c1-7-9(6-11(14)13(16)17)10-5-8(18-2)3-4-12(10)15-7;2*1-2/h3-5,11,15H,6,14H2,1-2H3,(H,16,17);2*1-2H3 |
| InChIKey | DHWKAGGEHIYXBD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|