C21H21NO5 — CID 70621341
[acetyloxy(phenyl)methyl] 2-(5-methoxy-2-methyl-1H-indol-3-yl)acetate (PubChem CID 70621341) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is [acetyloxy(phenyl)methyl] 2-(5-methoxy-2-methyl-1H-indol-3-yl)acetate.
| Compound Name | [acetyloxy(phenyl)methyl] 2-(5-methoxy-2-methyl-1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 70621341 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | [acetyloxy(phenyl)methyl] 2-(5-methoxy-2-methyl-1H-indol-3-yl)acetate |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)OC(OC(C)=O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C21H21NO5/c1-13-17(18-11-16(25-3)9-10-19(18)22-13)12-20(24)27-21(26-14(2)23)15-7-5-4-6-8-15/h4-11,21-22H,12H2,1-3H3 |
| InChIKey | RMVMKULEJFCYLF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|