C29H37N3O5 — CID 140634498
N-[(2S)-2-hydroxy-2-phenylethyl]-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide (PubChem CID 140634498) has the molecular formula C29H37N3O5 and a molecular weight of 507.63 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-2-phenylethyl]-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide.
| Compound Name | N-[(2S)-2-hydroxy-2-phenylethyl]-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide |
|---|---|
| PubChem CID | 140634498 |
| Molecular Formula | C29H37N3O5 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | N-[(2S)-2-hydroxy-2-phenylethyl]-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)NC(CCCCCC(C)=O)C(=O)NC[C@@H](O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C29H37N3O5/c1-19(33)10-6-4-9-13-26(29(36)30-18-27(34)21-11-7-5-8-12-21)32-28(35)17-23-20(2)31-25-15-14-22(37-3)16-24(23)25/h5,7-8,11-12,14-16,26-27,31,34H,4,6,9-10,13,17-18H2,1-3H3,(H,30,36)(H,32,35)/t26?,27-/m1/s1 |
| InChIKey | KDZPMOMYDZMAJD-SSYAZFEXSA-N |
| XLogP | 3.90 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|