C28H35N3O4 — CID 69328395
2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-N-(2-methylphenyl)-8-oxononanamide (PubChem CID 69328395) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is 2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-N-(2-methylphenyl)-8-oxononanamide.
| Compound Name | 2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-N-(2-methylphenyl)-8-oxononanamide |
|---|---|
| PubChem CID | 69328395 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-N-(2-methylphenyl)-8-oxononanamide |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)NC(CCCCCC(C)=O)C(=O)Nc3ccccc3C)c2c1 |
| InChI | InChI=1S/C28H35N3O4/c1-18-10-8-9-12-24(18)31-28(34)26(13-7-5-6-11-19(2)32)30-27(33)17-22-20(3)29-25-15-14-21(35-4)16-23(22)25/h8-10,12,14-16,26,29H,5-7,11,13,17H2,1-4H3,(H,30,33)(H,31,34) |
| InChIKey | OQAGUZVLEWLILL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|