C33H44N4O4 — CID 140634500
N-[(3S)-1-benzylpiperidin-3-yl]-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide (PubChem CID 140634500) has the molecular formula C33H44N4O4 and a molecular weight of 560.74 g/mol. Its IUPAC name is N-[(3S)-1-benzylpiperidin-3-yl]-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide.
| Compound Name | N-[(3S)-1-benzylpiperidin-3-yl]-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide |
|---|---|
| PubChem CID | 140634500 |
| Molecular Formula | C33H44N4O4 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | N-[(3S)-1-benzylpiperidin-3-yl]-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)NC(CCCCCC(C)=O)C(=O)N[C@H]3CCCN(Cc4ccccc4)C3)c2c1 |
| InChI | InChI=1S/C33H44N4O4/c1-23(38)11-6-4-9-15-31(33(40)35-26-14-10-18-37(22-26)21-25-12-7-5-8-13-25)36-32(39)20-28-24(2)34-30-17-16-27(41-3)19-29(28)30/h5,7-8,12-13,16-17,19,26,31,34H,4,6,9-11,14-15,18,20-22H2,1-3H3,(H,35,40)(H,36,39)/t26-,31?/m0/s1 |
| InChIKey | DMFPLPJGWDHBLS-PAMMARIWSA-N |
| XLogP | 4.83 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|