C33H42N4O4 — CID 140528445
N-(1-benzylpiperidin-4-ylidene)-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide (PubChem CID 140528445) has the molecular formula C33H42N4O4 and a molecular weight of 558.72 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-ylidene)-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide.
| Compound Name | N-(1-benzylpiperidin-4-ylidene)-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide |
|---|---|
| PubChem CID | 140528445 |
| Molecular Formula | C33H42N4O4 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | N-(1-benzylpiperidin-4-ylidene)-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)NC(CCCCCC(C)=O)C(=O)N=C3CCN(Cc4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C33H42N4O4/c1-23(38)10-6-4-9-13-31(33(40)35-26-16-18-37(19-17-26)22-25-11-7-5-8-12-25)36-32(39)21-28-24(2)34-30-15-14-27(41-3)20-29(28)30/h5,7-8,11-12,14-15,20,31,34H,4,6,9-10,13,16-19,21-22H2,1-3H3,(H,36,39) |
| InChIKey | RCRAUOLXDHHXSY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|