C27H31Cl2N3O4 — CID 69320577
(2S)-N-(3,4-dichlorophenyl)-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide (PubChem CID 69320577) has the molecular formula C27H31Cl2N3O4 and a molecular weight of 532.47 g/mol. Its IUPAC name is (2S)-N-(3,4-dichlorophenyl)-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide.
| Compound Name | (2S)-N-(3,4-dichlorophenyl)-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide |
|---|---|
| PubChem CID | 69320577 |
| Molecular Formula | C27H31Cl2N3O4 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | (2S)-N-(3,4-dichlorophenyl)-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)N[C@@H](CCCCCC(C)=O)C(=O)Nc3ccc(Cl)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C27H31Cl2N3O4/c1-16(33)7-5-4-6-8-25(27(35)31-18-9-11-22(28)23(29)13-18)32-26(34)15-20-17(2)30-24-12-10-19(36-3)14-21(20)24/h9-14,25,30H,4-8,15H2,1-3H3,(H,31,35)(H,32,34)/t25-/m0/s1 |
| InChIKey | ZGRQBKIXVBCMGB-VWLOTQADSA-N |
| XLogP | 6.00 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|