C28H33F2N3O4 — CID 69319270
(2S)-N-[(2,4-difluorophenyl)methyl]-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide (PubChem CID 69319270) has the molecular formula C28H33F2N3O4 and a molecular weight of 513.59 g/mol. Its IUPAC name is (2S)-N-[(2,4-difluorophenyl)methyl]-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide.
| Compound Name | (2S)-N-[(2,4-difluorophenyl)methyl]-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide |
|---|---|
| PubChem CID | 69319270 |
| Molecular Formula | C28H33F2N3O4 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | (2S)-N-[(2,4-difluorophenyl)methyl]-2-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-8-oxononanamide |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)N[C@@H](CCCCCC(C)=O)C(=O)NCc3ccc(F)cc3F)c2c1 |
| InChI | InChI=1S/C28H33F2N3O4/c1-17(34)7-5-4-6-8-26(28(36)31-16-19-9-10-20(29)13-24(19)30)33-27(35)15-22-18(2)32-25-12-11-21(37-3)14-23(22)25/h9-14,26,32H,4-8,15-16H2,1-3H3,(H,31,36)(H,33,35)/t26-/m0/s1 |
| InChIKey | IZKSEPYTPGFOAT-SANMLTNESA-N |
| XLogP | 4.65 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|