C13H15NO — CID 156558108
5-methoxy-2-methyl-3-prop-2-enyl-1H-indole (PubChem CID 156558108) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 5-methoxy-2-methyl-3-prop-2-enyl-1H-indole.
| Compound Name | 5-methoxy-2-methyl-3-prop-2-enyl-1H-indole |
|---|---|
| PubChem CID | 156558108 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 5-methoxy-2-methyl-3-prop-2-enyl-1H-indole |
| SMILES | C=CCc1c(C)[nH]c2ccc(OC)cc12 |
| InChI | InChI=1S/C13H15NO/c1-4-5-11-9(2)14-13-7-6-10(15-3)8-12(11)13/h4,6-8,14H,1,5H2,2-3H3 |
| InChIKey | BNVKDSQDKAWBMQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|