C25H30N6O2 — CID 69150487
2-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethylideneamino]guanidine (PubChem CID 69150487) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is 2-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethylideneamino]guanidine.
| Compound Name | 2-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethylideneamino]guanidine |
|---|---|
| PubChem CID | 69150487 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 2-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-1-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethylideneamino]guanidine |
| SMILES | COc1ccc2[nH]c(C)c(CC=NN/C(N)=N/CCc3c(C)[nH]c4ccc(OC)cc34)c2c1 |
| InChI | InChI=1S/C25H30N6O2/c1-15-19(21-13-17(32-3)5-7-23(21)29-15)9-11-27-25(26)31-28-12-10-20-16(2)30-24-8-6-18(33-4)14-22(20)24/h5-8,12-14,29-30H,9-11H2,1-4H3,(H3,26,27,31) |
| InChIKey | XQNWFCGACSSSHP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|