C26H28N2O3 — CID 7120421
2-[N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-C-methylcarbonimidoyl]-5-phenylcyclohexane-1,3-dione (PubChem CID 7120421) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-C-methylcarbonimidoyl]-5-phenylcyclohexane-1,3-dione.
| Compound Name | 2-[N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-C-methylcarbonimidoyl]-5-phenylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 7120421 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-[N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-C-methylcarbonimidoyl]-5-phenylcyclohexane-1,3-dione |
| SMILES | COc1ccc2[nH]c(C)c(CC/N=C(\C)C3C(=O)CC(c4ccccc4)CC3=O)c2c1 |
| InChI | InChI=1S/C26H28N2O3/c1-16-21(22-15-20(31-3)9-10-23(22)28-16)11-12-27-17(2)26-24(29)13-19(14-25(26)30)18-7-5-4-6-8-18/h4-10,15,19,26,28H,11-14H2,1-3H3/b27-17+ |
| InChIKey | IEVNWCAJUFRAKP-WPWMEQJKSA-N |
| XLogP | 4.82 |
| TPSA | 71.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|