C27H30N2O2 — CID 7288659
2-[N-[2-(2-methyl-1H-indol-3-yl)ethyl]-C-propylcarbonimidoyl]-5-phenylcyclohexane-1,3-dione (PubChem CID 7288659) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-[N-[2-(2-methyl-1H-indol-3-yl)ethyl]-C-propylcarbonimidoyl]-5-phenylcyclohexane-1,3-dione.
| Compound Name | 2-[N-[2-(2-methyl-1H-indol-3-yl)ethyl]-C-propylcarbonimidoyl]-5-phenylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 7288659 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 2-[N-[2-(2-methyl-1H-indol-3-yl)ethyl]-C-propylcarbonimidoyl]-5-phenylcyclohexane-1,3-dione |
| SMILES | CCC/C(=N\CCc1c(C)[nH]c2ccccc12)C1C(=O)CC(c2ccccc2)CC1=O |
| InChI | InChI=1S/C27H30N2O2/c1-3-9-24(28-15-14-21-18(2)29-23-13-8-7-12-22(21)23)27-25(30)16-20(17-26(27)31)19-10-5-4-6-11-19/h4-8,10-13,20,27,29H,3,9,14-17H2,1-2H3/b28-24+ |
| InChIKey | OJRIGUQXSARDDP-ZZIIXHQDSA-N |
| XLogP | 5.59 |
| TPSA | 62.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|