C26H31NO4 — CID 7370063
2-[N-[2-(3,4-dimethoxyphenyl)ethyl]-C-propylcarbonimidoyl]-5-phenylcyclohexane-1,3-dione (PubChem CID 7370063) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-[N-[2-(3,4-dimethoxyphenyl)ethyl]-C-propylcarbonimidoyl]-5-phenylcyclohexane-1,3-dione.
| Compound Name | 2-[N-[2-(3,4-dimethoxyphenyl)ethyl]-C-propylcarbonimidoyl]-5-phenylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 7370063 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 2-[N-[2-(3,4-dimethoxyphenyl)ethyl]-C-propylcarbonimidoyl]-5-phenylcyclohexane-1,3-dione |
| SMILES | CCC/C(=N\CCc1ccc(OC)c(OC)c1)C1C(=O)CC(c2ccccc2)CC1=O |
| InChI | InChI=1S/C26H31NO4/c1-4-8-21(27-14-13-18-11-12-24(30-2)25(15-18)31-3)26-22(28)16-20(17-23(26)29)19-9-6-5-7-10-19/h5-7,9-12,15,20,26H,4,8,13-14,16-17H2,1-3H3/b27-21+ |
| InChIKey | BVFFVOVDZHXSKS-SZXQPVLSSA-N |
| XLogP | 4.82 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|