C22H31N2O6P — CID 24834595
N-[2-(3,4-dimethoxyphenyl)ethyl]-1-ethyl-4-phenylpyrrolidin-2-imine;phosphoric acid (PubChem CID 24834595) has the molecular formula C22H31N2O6P and a molecular weight of 450.47 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-1-ethyl-4-phenylpyrrolidin-2-imine;phosphoric acid.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-1-ethyl-4-phenylpyrrolidin-2-imine;phosphoric acid |
|---|---|
| PubChem CID | 24834595 |
| Molecular Formula | C22H31N2O6P |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-1-ethyl-4-phenylpyrrolidin-2-imine;phosphoric acid |
| SMILES | CCN1CC(c2ccccc2)C/C1=N/CCc1ccc(OC)c(OC)c1.O=P(O)(O)O |
| InChI | InChI=1S/C22H28N2O2.H3O4P/c1-4-24-16-19(18-8-6-5-7-9-18)15-22(24)23-13-12-17-10-11-20(25-2)21(14-17)26-3;1-5(2,3)4/h5-11,14,19H,4,12-13,15-16H2,1-3H3;(H3,1,2,3,4)/b23-22-; |
| InChIKey | JYVISGAUAIFEIX-YJACDMIVSA-N |
| XLogP | 3.23 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|