C32H40N2O5 — CID 92524691
(3R,6S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-4-[2-(3,4-dimethoxyphenyl)ethylimino]-3-methyl-6-phenylpiperidin-3-ol (PubChem CID 92524691) has the molecular formula C32H40N2O5 and a molecular weight of 532.68 g/mol. Its IUPAC name is (3R,6S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-4-[2-(3,4-dimethoxyphenyl)ethylimino]-3-methyl-6-phenylpiperidin-3-ol.
| Compound Name | (3R,6S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-4-[2-(3,4-dimethoxyphenyl)ethylimino]-3-methyl-6-phenylpiperidin-3-ol |
|---|---|
| PubChem CID | 92524691 |
| Molecular Formula | C32H40N2O5 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | (3R,6S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-4-[2-(3,4-dimethoxyphenyl)ethylimino]-3-methyl-6-phenylpiperidin-3-ol |
| SMILES | COc1ccc(CC/N=C2\C[C@@H](c3ccccc3)N(CCc3ccc(OC)c(OC)c3)C[C@@]2(C)O)cc1OC |
| InChI | InChI=1S/C32H40N2O5/c1-32(35)22-34(18-16-24-12-14-28(37-3)30(20-24)39-5)26(25-9-7-6-8-10-25)21-31(32)33-17-15-23-11-13-27(36-2)29(19-23)38-4/h6-14,19-20,26,35H,15-18,21-22H2,1-5H3/b33-31+/t26-,32+/m0/s1 |
| InChIKey | TYHNYIKMAKFKGA-QEUAJMCASA-N |
| XLogP | 5.15 |
| TPSA | 72.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|