C15H22N2O2S — CID 135934558
N-[2-(3,4-dimethoxyphenyl)ethyl]-4,4-dimethyl-1,3-thiazolidin-2-imine (PubChem CID 135934558) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4,4-dimethyl-1,3-thiazolidin-2-imine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4,4-dimethyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 135934558 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4,4-dimethyl-1,3-thiazolidin-2-imine |
| SMILES | COc1ccc(CC/N=C2/NC(C)(C)CS2)cc1OC |
| InChI | InChI=1S/C15H22N2O2S/c1-15(2)10-20-14(17-15)16-8-7-11-5-6-12(18-3)13(9-11)19-4/h5-6,9H,7-8,10H2,1-4H3,(H,16,17) |
| InChIKey | GWGKWJSBSRDSQO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|